C29H33N7O — CID 127028160
(11R,15S)-5-anilino-8-methyl-4-[[4-(1-methylpyrrolidin-2-yl)phenyl]methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one (PubChem CID 127028160) has the molecular formula C29H33N7O and a molecular weight of 495.63 g/mol. Its IUPAC name is (11R,15S)-5-anilino-8-methyl-4-[[4-(1-methylpyrrolidin-2-yl)phenyl]methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one.
| Compound Name | (11R,15S)-5-anilino-8-methyl-4-[[4-(1-methylpyrrolidin-2-yl)phenyl]methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 127028160 |
| Molecular Formula | C29H33N7O |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | (11R,15S)-5-anilino-8-methyl-4-[[4-(1-methylpyrrolidin-2-yl)phenyl]methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
| SMILES | CN1C(=O)c2c(nn(Cc3ccc(C4CCCN4C)cc3)c2Nc2ccccc2)N2C1=N[C@@H]1CCC[C@@H]12 |
| InChI | InChI=1S/C29H33N7O/c1-33-17-7-12-23(33)20-15-13-19(14-16-20)18-35-26(30-21-8-4-3-5-9-21)25-27(32-35)36-24-11-6-10-22(24)31-29(36)34(2)28(25)37/h3-5,8-9,13-16,22-24,30H,6-7,10-12,17-18H2,1-2H3/t22-,23?,24+/m1/s1 |
| InChIKey | WOPLKWAXRNVSIH-BGTNVORWSA-N |
| XLogP | 4.62 |
| TPSA | 69.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |