About 2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-nitrophenyl)phenyl]ethanol
2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-nitrophenyl)phenyl]ethanol (PubChem CID 127028217) has the molecular formula C22H20N2O7
and a molecular weight of 424.41 g/mol. Its IUPAC name is 2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-nitrophenyl)phenyl]ethanol.
Molecular Properties
| Compound Name | 2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-nitrophenyl)phenyl]ethanol |
| PubChem CID | 127028217 |
| Molecular Formula | C22H20N2O7 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-nitrophenyl)phenyl]ethanol |
| SMILES | COc1cc(CC(O)c2ccc(-c3ccc([N+](=O)[O-])cc3)cc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C22H20N2O7/c1-30-21-12-17(19(24(28)29)13-22(21)31-2)11-20(25)16-5-3-14(4-6-16)15-7-9-18(10-8-15)23(26)27/h3-10,12-13,20,25H,11H2,1-2H3 |
| InChIKey | OPUSLQLRQWDHEE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 124.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-nitrophenyl)phenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-nitrophenyl)phenyl]ethanol?
The IUPAC name of 2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-nitrophenyl)phenyl]ethanol (CID 127028217) is 2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-nitrophenyl)phenyl]ethanol.
What is the SMILES notation for 2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-nitrophenyl)phenyl]ethanol?
The canonical SMILES for 2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-nitrophenyl)phenyl]ethanol is COc1cc(CC(O)c2ccc(-c3ccc([N+](=O)[O-])cc3)cc2)c([N+](=O)[O-])cc1OC.
What is the InChIKey of 2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-nitrophenyl)phenyl]ethanol?
The InChIKey is OPUSLQLRQWDHEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2O7/c1-30-21-12-17(19(24(28)29)13-22(21)31-2)11-20(25)16-5-3-14(4-6-16)15-7-9-18(10-8-15)23(26)27/h3-10,12-13,20,25H,11H2,1-2H3.
What are the key properties of 2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-nitrophenyl)phenyl]ethanol?
2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-nitrophenyl)phenyl]ethanol has a molecular weight of 424.41 g/mol, XLogP of 4.46, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-nitrophenyl)phenyl]ethanol is sourced from PubChem (CID 127028217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).