About 2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-methylphenyl)phenyl]ethanol
2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-methylphenyl)phenyl]ethanol (PubChem CID 127028234) has the molecular formula C23H23NO5
and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-methylphenyl)phenyl]ethanol.
Molecular Properties
| Compound Name | 2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-methylphenyl)phenyl]ethanol |
| PubChem CID | 127028234 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-methylphenyl)phenyl]ethanol |
| SMILES | COc1cc(CC(O)c2ccc(-c3ccc(C)cc3)cc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C23H23NO5/c1-15-4-6-16(7-5-15)17-8-10-18(11-9-17)21(25)12-19-13-22(28-2)23(29-3)14-20(19)24(26)27/h4-11,13-14,21,25H,12H2,1-3H3 |
| InChIKey | KVRIOBMGNXKJCV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-methylphenyl)phenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-methylphenyl)phenyl]ethanol?
The IUPAC name of 2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-methylphenyl)phenyl]ethanol (CID 127028234) is 2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-methylphenyl)phenyl]ethanol.
What is the SMILES notation for 2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-methylphenyl)phenyl]ethanol?
The canonical SMILES for 2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-methylphenyl)phenyl]ethanol is COc1cc(CC(O)c2ccc(-c3ccc(C)cc3)cc2)c([N+](=O)[O-])cc1OC.
What is the InChIKey of 2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-methylphenyl)phenyl]ethanol?
The InChIKey is KVRIOBMGNXKJCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23NO5/c1-15-4-6-16(7-5-15)17-8-10-18(11-9-17)21(25)12-19-13-22(28-2)23(29-3)14-20(19)24(26)27/h4-11,13-14,21,25H,12H2,1-3H3.
What are the key properties of 2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-methylphenyl)phenyl]ethanol?
2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-methylphenyl)phenyl]ethanol has a molecular weight of 393.44 g/mol, XLogP of 4.86, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethoxy-2-nitrophenyl)-1-[4-(4-methylphenyl)phenyl]ethanol is sourced from PubChem (CID 127028234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).