C13H14O3 — CID 127028248
(1R,8aR)-7-methoxy-1,8a-dimethyl-1H-naphthalene-2,6-dione (PubChem CID 127028248) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is (1R,8aR)-7-methoxy-1,8a-dimethyl-1H-naphthalene-2,6-dione.
| Compound Name | (1R,8aR)-7-methoxy-1,8a-dimethyl-1H-naphthalene-2,6-dione |
|---|---|
| PubChem CID | 127028248 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (1R,8aR)-7-methoxy-1,8a-dimethyl-1H-naphthalene-2,6-dione |
| SMILES | COC1=C[C@@]2(C)C(=CC1=O)C=CC(=O)[C@@H]2C |
| InChI | InChI=1S/C13H14O3/c1-8-10(14)5-4-9-6-11(15)12(16-3)7-13(8,9)2/h4-8H,1-3H3/t8-,13+/m0/s1 |
| InChIKey | XBZLOAHFAPHEHT-ISVAXAHUSA-N |
| XLogP | 1.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |