C11H12IN — CID 127028296
6-(3-iodophenyl)-2,3,4,5-tetrahydropyridine (PubChem CID 127028296) has the molecular formula C11H12IN and a molecular weight of 285.13 g/mol. Its IUPAC name is 6-(3-iodophenyl)-2,3,4,5-tetrahydropyridine.
| Compound Name | 6-(3-iodophenyl)-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 127028296 |
| Molecular Formula | C11H12IN |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 6-(3-iodophenyl)-2,3,4,5-tetrahydropyridine |
| SMILES | Ic1cccc(C2=NCCCC2)c1 |
| InChI | InChI=1S/C11H12IN/c12-10-5-3-4-9(8-10)11-6-1-2-7-13-11/h3-5,8H,1-2,6-7H2 |
| InChIKey | WWXZQSSSEUIZDN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|