About 1-N-(1-adamantylmethyl)-3-N-(7-chloro-3-fluoroquinolin-2-yl)butane-1,3-diamine
1-N-(1-adamantylmethyl)-3-N-(7-chloro-3-fluoroquinolin-2-yl)butane-1,3-diamine (PubChem CID 127028333) has the molecular formula C24H31ClFN3
and a molecular weight of 415.98 g/mol. Its IUPAC name is 1-N-(1-adamantylmethyl)-3-N-(7-chloro-3-fluoroquinolin-2-yl)butane-1,3-diamine.
Molecular Properties
| Compound Name | 1-N-(1-adamantylmethyl)-3-N-(7-chloro-3-fluoroquinolin-2-yl)butane-1,3-diamine |
| PubChem CID | 127028333 |
| Molecular Formula | C24H31ClFN3 |
| Molecular Weight | 415.98 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | 1-N-(1-adamantylmethyl)-3-N-(7-chloro-3-fluoroquinolin-2-yl)butane-1,3-diamine |
| SMILES | CC(CCNCC12CC3CC(CC(C3)C1)C2)Nc1nc2cc(Cl)ccc2cc1F |
| InChI | InChI=1S/C24H31ClFN3/c1-15(28-23-21(26)9-19-2-3-20(25)10-22(19)29-23)4-5-27-14-24-11-16-6-17(12-24)8-18(7-16)13-24/h2-3,9-10,15-18,27H,4-8,11-14H2,1H3,(H,28,29) |
| InChIKey | KLCKWVJSRMUFFA-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.98 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-N-(1-adamantylmethyl)-3-N-(7-chloro-3-fluoroquinolin-2-yl)butane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(1-adamantylmethyl)-3-N-(7-chloro-3-fluoroquinolin-2-yl)butane-1,3-diamine?
The IUPAC name of 1-N-(1-adamantylmethyl)-3-N-(7-chloro-3-fluoroquinolin-2-yl)butane-1,3-diamine (CID 127028333) is 1-N-(1-adamantylmethyl)-3-N-(7-chloro-3-fluoroquinolin-2-yl)butane-1,3-diamine.
What is the SMILES notation for 1-N-(1-adamantylmethyl)-3-N-(7-chloro-3-fluoroquinolin-2-yl)butane-1,3-diamine?
The canonical SMILES for 1-N-(1-adamantylmethyl)-3-N-(7-chloro-3-fluoroquinolin-2-yl)butane-1,3-diamine is CC(CCNCC12CC3CC(CC(C3)C1)C2)Nc1nc2cc(Cl)ccc2cc1F.
What is the InChIKey of 1-N-(1-adamantylmethyl)-3-N-(7-chloro-3-fluoroquinolin-2-yl)butane-1,3-diamine?
The InChIKey is KLCKWVJSRMUFFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31ClFN3/c1-15(28-23-21(26)9-19-2-3-20(25)10-22(19)29-23)4-5-27-14-24-11-16-6-17(12-24)8-18(7-16)13-24/h2-3,9-10,15-18,27H,4-8,11-14H2,1H3,(H,28,29).
What are the key properties of 1-N-(1-adamantylmethyl)-3-N-(7-chloro-3-fluoroquinolin-2-yl)butane-1,3-diamine?
1-N-(1-adamantylmethyl)-3-N-(7-chloro-3-fluoroquinolin-2-yl)butane-1,3-diamine has a molecular weight of 415.98 g/mol, XLogP of 6.02, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(1-adamantylmethyl)-3-N-(7-chloro-3-fluoroquinolin-2-yl)butane-1,3-diamine is sourced from PubChem (CID 127028333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).