C28H25N3O4 — CID 127028347
methyl 4-[4-[3-[5-(1H-indol-3-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]phenoxy]butanoate (PubChem CID 127028347) has the molecular formula C28H25N3O4 and a molecular weight of 467.53 g/mol. Its IUPAC name is methyl 4-[4-[3-[5-(1H-indol-3-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]phenoxy]butanoate.
| Compound Name | methyl 4-[4-[3-[5-(1H-indol-3-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 127028347 |
| Molecular Formula | C28H25N3O4 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | methyl 4-[4-[3-[5-(1H-indol-3-ylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]phenoxy]butanoate |
| SMILES | COC(=O)CCCOc1ccc(-c2cccc(-c3noc(Cc4c[nH]c5ccccc45)n3)c2)cc1 |
| InChI | InChI=1S/C28H25N3O4/c1-33-27(32)10-5-15-34-23-13-11-19(12-14-23)20-6-4-7-21(16-20)28-30-26(35-31-28)17-22-18-29-25-9-3-2-8-24(22)25/h2-4,6-9,11-14,16,18,29H,5,10,15,17H2,1H3 |
| InChIKey | NZHGQSSPEOWUFK-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|