C26H22N2O3 — CID 127028414
5-[(4-methoxyphenyl)methyl]-12-(2-methyl-4-pyridinyl)-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,11,13-pentaen-2-one (PubChem CID 127028414) has the molecular formula C26H22N2O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)methyl]-12-(2-methyl-4-pyridinyl)-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,11,13-pentaen-2-one.
| Compound Name | 5-[(4-methoxyphenyl)methyl]-12-(2-methyl-4-pyridinyl)-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,11,13-pentaen-2-one |
|---|---|
| PubChem CID | 127028414 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 5-[(4-methoxyphenyl)methyl]-12-(2-methyl-4-pyridinyl)-6-oxa-4-azatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,11,13-pentaen-2-one |
| SMILES | COc1ccc(Cc2nc3c(o2)CCc2cc(-c4ccnc(C)c4)ccc2C3=O)cc1 |
| InChI | InChI=1S/C26H22N2O3/c1-16-13-19(11-12-27-16)18-5-9-22-20(15-18)6-10-23-25(26(22)29)28-24(31-23)14-17-3-7-21(30-2)8-4-17/h3-5,7-9,11-13,15H,6,10,14H2,1-2H3 |
| InChIKey | LGACBXRBHHAKSE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |