C25H24N4O2 — CID 127028415
5-[(4-methoxyphenyl)methyl]-6-methyl-12-(4-methylimidazol-1-yl)-4,6-diazatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,11,13-pentaen-2-one (PubChem CID 127028415) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)methyl]-6-methyl-12-(4-methylimidazol-1-yl)-4,6-diazatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,11,13-pentaen-2-one.
| Compound Name | 5-[(4-methoxyphenyl)methyl]-6-methyl-12-(4-methylimidazol-1-yl)-4,6-diazatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,11,13-pentaen-2-one |
|---|---|
| PubChem CID | 127028415 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 5-[(4-methoxyphenyl)methyl]-6-methyl-12-(4-methylimidazol-1-yl)-4,6-diazatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,11,13-pentaen-2-one |
| SMILES | COc1ccc(Cc2nc3c(n2C)CCc2cc(-n4cnc(C)c4)ccc2C3=O)cc1 |
| InChI | InChI=1S/C25H24N4O2/c1-16-14-29(15-26-16)19-7-10-21-18(13-19)6-11-22-24(25(21)30)27-23(28(22)2)12-17-4-8-20(31-3)9-5-17/h4-5,7-10,13-15H,6,11-12H2,1-3H3 |
| InChIKey | GGFWGRUHYCDYLI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |