C25H20FN3O — CID 127028417
5-[(4-fluorophenyl)methyl]-13-(4-methylimidazol-1-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one (PubChem CID 127028417) has the molecular formula C25H20FN3O and a molecular weight of 397.45 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methyl]-13-(4-methylimidazol-1-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one.
| Compound Name | 5-[(4-fluorophenyl)methyl]-13-(4-methylimidazol-1-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one |
|---|---|
| PubChem CID | 127028417 |
| Molecular Formula | C25H20FN3O |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 5-[(4-fluorophenyl)methyl]-13-(4-methylimidazol-1-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one |
| SMILES | Cc1cn(-c2ccc3c(c2)CCc2ccc(Cc4ccc(F)cc4)nc2C3=O)cn1 |
| InChI | InChI=1S/C25H20FN3O/c1-16-14-29(15-27-16)22-10-11-23-19(13-22)5-4-18-6-9-21(28-24(18)25(23)30)12-17-2-7-20(26)8-3-17/h2-3,6-11,13-15H,4-5,12H2,1H3 |
| InChIKey | PIRCMEXOPRAHHM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |