acetic acid;4-(5-phenylfuran-2-yl)benzenecarboximidamide

C19H18N2O3 — CID 127028432

IUPACacetic acid;4-(5-phenylfuran-2-yl)benzenecarboximidamide
SMILESCC(=O)O.[H]/N=C(\N)c1ccc(-c2ccc(-c3ccccc3)o2)cc1
InChIInChI=1S/C17H14N2O.C2H4O2/c18-17(19)14-8-6-13(7-9-14)16-11-10-15(20-16)12-4-2-1-3-5-12;1-2(3)4/h1-11H,(H3,18,19);1H3,(H,3,4)
InChIKeyMHVFYPJGWYVWOZ-UHFFFAOYSA-N
MW322.36 g/mol
LogP3.99
Rot. Bonds3

About acetic acid;4-(5-phenylfuran-2-yl)benzenecarboximidamide

acetic acid;4-(5-phenylfuran-2-yl)benzenecarboximidamide (PubChem CID 127028432) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is acetic acid;4-(5-phenylfuran-2-yl)benzenecarboximidamide.

Molecular Properties

Compound Nameacetic acid;4-(5-phenylfuran-2-yl)benzenecarboximidamide
PubChem CID127028432
Molecular FormulaC19H18N2O3
Molecular Weight322.36 g/mol
Exact Mass322.13
IUPAC Nameacetic acid;4-(5-phenylfuran-2-yl)benzenecarboximidamide
SMILESCC(=O)O.[H]/N=C(\N)c1ccc(-c2ccc(-c3ccccc3)o2)cc1
InChIInChI=1S/C17H14N2O.C2H4O2/c18-17(19)14-8-6-13(7-9-14)16-11-10-15(20-16)12-4-2-1-3-5-12;1-2(3)4/h1-11H,(H3,18,19);1H3,(H,3,4)
InChIKeyMHVFYPJGWYVWOZ-UHFFFAOYSA-N
XLogP3.99
TPSA100.31 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500322.36
LogP ≤ 53.99
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}

Analyze acetic acid;4-(5-phenylfuran-2-yl)benzenecarboximidamide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;4-(5-phenylfuran-2-yl)benzenecarboximidamide?
The IUPAC name of acetic acid;4-(5-phenylfuran-2-yl)benzenecarboximidamide (CID 127028432) is acetic acid;4-(5-phenylfuran-2-yl)benzenecarboximidamide.
What is the SMILES notation for acetic acid;4-(5-phenylfuran-2-yl)benzenecarboximidamide?
The canonical SMILES for acetic acid;4-(5-phenylfuran-2-yl)benzenecarboximidamide is CC(=O)O.[H]/N=C(\N)c1ccc(-c2ccc(-c3ccccc3)o2)cc1.
What is the InChIKey of acetic acid;4-(5-phenylfuran-2-yl)benzenecarboximidamide?
The InChIKey is MHVFYPJGWYVWOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O.C2H4O2/c18-17(19)14-8-6-13(7-9-14)16-11-10-15(20-16)12-4-2-1-3-5-12;1-2(3)4/h1-11H,(H3,18,19);1H3,(H,3,4).
What are the key properties of acetic acid;4-(5-phenylfuran-2-yl)benzenecarboximidamide?
acetic acid;4-(5-phenylfuran-2-yl)benzenecarboximidamide has a molecular weight of 322.36 g/mol, XLogP of 3.99, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;4-(5-phenylfuran-2-yl)benzenecarboximidamide is sourced from PubChem (CID 127028432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).