C17H15FN4OS2 — CID 127028450
2-[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]ethyl N-(pyridin-3-ylmethyl)carbamodithioate (PubChem CID 127028450) has the molecular formula C17H15FN4OS2 and a molecular weight of 374.47 g/mol. Its IUPAC name is 2-[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]ethyl N-(pyridin-3-ylmethyl)carbamodithioate.
| Compound Name | 2-[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]ethyl N-(pyridin-3-ylmethyl)carbamodithioate |
|---|---|
| PubChem CID | 127028450 |
| Molecular Formula | C17H15FN4OS2 |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 2-[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]ethyl N-(pyridin-3-ylmethyl)carbamodithioate |
| SMILES | Fc1ccccc1-c1nnc(CCSC(=S)NCc2cccnc2)o1 |
| InChI | InChI=1S/C17H15FN4OS2/c18-14-6-2-1-5-13(14)16-22-21-15(23-16)7-9-25-17(24)20-11-12-4-3-8-19-10-12/h1-6,8,10H,7,9,11H2,(H,20,24) |
| InChIKey | YLHNFAWZCWHSGB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_carbam_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|