C18H18N4O2S2 — CID 127028451
2-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]ethyl N-(pyridin-3-ylmethyl)carbamodithioate (PubChem CID 127028451) has the molecular formula C18H18N4O2S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 2-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]ethyl N-(pyridin-3-ylmethyl)carbamodithioate.
| Compound Name | 2-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]ethyl N-(pyridin-3-ylmethyl)carbamodithioate |
|---|---|
| PubChem CID | 127028451 |
| Molecular Formula | C18H18N4O2S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 2-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]ethyl N-(pyridin-3-ylmethyl)carbamodithioate |
| SMILES | COc1ccc(-c2nnc(CCSC(=S)NCc3cccnc3)o2)cc1 |
| InChI | InChI=1S/C18H18N4O2S2/c1-23-15-6-4-14(5-7-15)17-22-21-16(24-17)8-10-26-18(25)20-12-13-3-2-9-19-11-13/h2-7,9,11H,8,10,12H2,1H3,(H,20,25) |
| InChIKey | BFBSOTYAPQTWLK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_carbam_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|