C18H15F3N4OS2 — CID 127028452
2-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]ethyl N-(pyridin-3-ylmethyl)carbamodithioate (PubChem CID 127028452) has the molecular formula C18H15F3N4OS2 and a molecular weight of 424.47 g/mol. Its IUPAC name is 2-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]ethyl N-(pyridin-3-ylmethyl)carbamodithioate.
| Compound Name | 2-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]ethyl N-(pyridin-3-ylmethyl)carbamodithioate |
|---|---|
| PubChem CID | 127028452 |
| Molecular Formula | C18H15F3N4OS2 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 2-[5-[4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]ethyl N-(pyridin-3-ylmethyl)carbamodithioate |
| SMILES | FC(F)(F)c1ccc(-c2nnc(CCSC(=S)NCc3cccnc3)o2)cc1 |
| InChI | InChI=1S/C18H15F3N4OS2/c19-18(20,21)14-5-3-13(4-6-14)16-25-24-15(26-16)7-9-28-17(27)23-11-12-2-1-8-22-10-12/h1-6,8,10H,7,9,11H2,(H,23,27) |
| InChIKey | KMKHTZIIYQYEHM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_carbam_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|