C26H47BN2O5 — CID 127028490
tert-butyl N-[(2S)-4-methyl-1-oxo-1-[[(1R)-1-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pentyl]amino]pentan-2-yl]carbamate (PubChem CID 127028490) has the molecular formula C26H47BN2O5 and a molecular weight of 478.48 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-methyl-1-oxo-1-[[(1R)-1-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pentyl]amino]pentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4-methyl-1-oxo-1-[[(1R)-1-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pentyl]amino]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 127028490 |
| Molecular Formula | C26H47BN2O5 |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.36 |
| IUPAC Name | tert-butyl N-[(2S)-4-methyl-1-oxo-1-[[(1R)-1-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pentyl]amino]pentan-2-yl]carbamate |
| SMILES | CCCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)OC(C)(C)C)B1OC2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C26H47BN2O5/c1-10-11-12-21(27-33-20-15-17-14-19(25(17,7)8)26(20,9)34-27)29-22(30)18(13-16(2)3)28-23(31)32-24(4,5)6/h16-21H,10-15H2,1-9H3,(H,28,31)(H,29,30)/t17-,18-,19-,20?,21-,26-/m0/s1 |
| InChIKey | UWJYWRHUTFELAL-NYOZYDQVSA-N |
| XLogP | 4.87 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|