C31H40ClN3O5S2 — CID 127028529
9-benzyl-1-(4-methoxyphenyl)sulfonyl-3-methylidene-5-(4-methylphenyl)sulfonyl-1,5,9-triazacyclododecane;hydrochloride (PubChem CID 127028529) has the molecular formula C31H40ClN3O5S2 and a molecular weight of 634.26 g/mol. Its IUPAC name is 9-benzyl-1-(4-methoxyphenyl)sulfonyl-3-methylidene-5-(4-methylphenyl)sulfonyl-1,5,9-triazacyclododecane;hydrochloride.
| Compound Name | 9-benzyl-1-(4-methoxyphenyl)sulfonyl-3-methylidene-5-(4-methylphenyl)sulfonyl-1,5,9-triazacyclododecane;hydrochloride |
|---|---|
| PubChem CID | 127028529 |
| Molecular Formula | C31H40ClN3O5S2 |
| Molecular Weight | 634.26 g/mol |
| Exact Mass | 633.21 |
| IUPAC Name | 9-benzyl-1-(4-methoxyphenyl)sulfonyl-3-methylidene-5-(4-methylphenyl)sulfonyl-1,5,9-triazacyclododecane;hydrochloride |
| SMILES | C=C1CN(S(=O)(=O)c2ccc(C)cc2)CCCN(Cc2ccccc2)CCCN(S(=O)(=O)c2ccc(OC)cc2)C1.Cl |
| InChI | InChI=1S/C31H39N3O5S2.ClH/c1-26-11-15-30(16-12-26)40(35,36)33-21-7-19-32(25-28-9-5-4-6-10-28)20-8-22-34(24-27(2)23-33)41(37,38)31-17-13-29(39-3)14-18-31;/h4-6,9-18H,2,7-8,19-25H2,1,3H3;1H |
| InChIKey | MVQDIABQVAUPIX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.26 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|