C20H15F9N2O3S — CID 127028567
N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1-methyl-N-(2,2,2-trifluoroethyl)indole-4-sulfonamide (PubChem CID 127028567) has the molecular formula C20H15F9N2O3S and a molecular weight of 534.40 g/mol. Its IUPAC name is N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1-methyl-N-(2,2,2-trifluoroethyl)indole-4-sulfonamide.
| Compound Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1-methyl-N-(2,2,2-trifluoroethyl)indole-4-sulfonamide |
|---|---|
| PubChem CID | 127028567 |
| Molecular Formula | C20H15F9N2O3S |
| Molecular Weight | 534.40 g/mol |
| Exact Mass | 534.07 |
| IUPAC Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1-methyl-N-(2,2,2-trifluoroethyl)indole-4-sulfonamide |
| SMILES | Cn1ccc2c(S(=O)(=O)N(CC(F)(F)F)c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)cccc21 |
| InChI | InChI=1S/C20H15F9N2O3S/c1-30-10-9-14-15(30)3-2-4-16(14)35(33,34)31(11-17(21,22)23)13-7-5-12(6-8-13)18(32,19(24,25)26)20(27,28)29/h2-10,32H,11H2,1H3 |
| InChIKey | UOYYRTPEBDTAPD-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.40 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |