About (2R)-N,3-dihydroxy-2-[[4-(2-phenylethynyl)phenyl]methoxy]propanamide
(2R)-N,3-dihydroxy-2-[[4-(2-phenylethynyl)phenyl]methoxy]propanamide (PubChem CID 127028645) has the molecular formula C18H17NO4
and a molecular weight of 311.34 g/mol. Its IUPAC name is (2R)-N,3-dihydroxy-2-[[4-(2-phenylethynyl)phenyl]methoxy]propanamide.
Molecular Properties
| Compound Name | (2R)-N,3-dihydroxy-2-[[4-(2-phenylethynyl)phenyl]methoxy]propanamide |
| PubChem CID | 127028645 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (2R)-N,3-dihydroxy-2-[[4-(2-phenylethynyl)phenyl]methoxy]propanamide |
| SMILES | O=C(NO)[C@@H](CO)OCc1ccc(C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C18H17NO4/c20-12-17(18(21)19-22)23-13-16-10-8-15(9-11-16)7-6-14-4-2-1-3-5-14/h1-5,8-11,17,20,22H,12-13H2,(H,19,21)/t17-/m1/s1 |
| InChIKey | QCLCDFIDVGJXRB-QGZVFWFLSA-N |
| XLogP | 1.47 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-N,3-dihydroxy-2-[[4-(2-phenylethynyl)phenyl]methoxy]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N,3-dihydroxy-2-[[4-(2-phenylethynyl)phenyl]methoxy]propanamide?
The IUPAC name of (2R)-N,3-dihydroxy-2-[[4-(2-phenylethynyl)phenyl]methoxy]propanamide (CID 127028645) is (2R)-N,3-dihydroxy-2-[[4-(2-phenylethynyl)phenyl]methoxy]propanamide.
What is the SMILES notation for (2R)-N,3-dihydroxy-2-[[4-(2-phenylethynyl)phenyl]methoxy]propanamide?
The canonical SMILES for (2R)-N,3-dihydroxy-2-[[4-(2-phenylethynyl)phenyl]methoxy]propanamide is O=C(NO)[C@@H](CO)OCc1ccc(C#Cc2ccccc2)cc1.
What is the InChIKey of (2R)-N,3-dihydroxy-2-[[4-(2-phenylethynyl)phenyl]methoxy]propanamide?
The InChIKey is QCLCDFIDVGJXRB-QGZVFWFLSA-N. The full InChI is InChI=1S/C18H17NO4/c20-12-17(18(21)19-22)23-13-16-10-8-15(9-11-16)7-6-14-4-2-1-3-5-14/h1-5,8-11,17,20,22H,12-13H2,(H,19,21)/t17-/m1/s1.
What are the key properties of (2R)-N,3-dihydroxy-2-[[4-(2-phenylethynyl)phenyl]methoxy]propanamide?
(2R)-N,3-dihydroxy-2-[[4-(2-phenylethynyl)phenyl]methoxy]propanamide has a molecular weight of 311.34 g/mol, XLogP of 1.47, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N,3-dihydroxy-2-[[4-(2-phenylethynyl)phenyl]methoxy]propanamide is sourced from PubChem (CID 127028645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).