C25H34O6 — CID 127028674
(6aR,9R,9aR)-9-decanoyl-3-[(2S)-2-hydroxypropyl]-6a-methyl-9,9a-dihydrofuro[2,3-h]isochromene-6,8-dione (PubChem CID 127028674) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is (6aR,9R,9aR)-9-decanoyl-3-[(2S)-2-hydroxypropyl]-6a-methyl-9,9a-dihydrofuro[2,3-h]isochromene-6,8-dione.
| Compound Name | (6aR,9R,9aR)-9-decanoyl-3-[(2S)-2-hydroxypropyl]-6a-methyl-9,9a-dihydrofuro[2,3-h]isochromene-6,8-dione |
|---|---|
| PubChem CID | 127028674 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | (6aR,9R,9aR)-9-decanoyl-3-[(2S)-2-hydroxypropyl]-6a-methyl-9,9a-dihydrofuro[2,3-h]isochromene-6,8-dione |
| SMILES | CCCCCCCCCC(=O)[C@@H]1C(=O)O[C@@]2(C)C(=O)C=C3C=C(C[C@H](C)O)OC=C3[C@@H]12 |
| InChI | InChI=1S/C25H34O6/c1-4-5-6-7-8-9-10-11-20(27)22-23-19-15-30-18(12-16(2)26)13-17(19)14-21(28)25(23,3)31-24(22)29/h13-16,22-23,26H,4-12H2,1-3H3/t16-,22-,23-,25-/m0/s1 |
| InChIKey | NOYCARDZFHRQBB-XNHCRPTKSA-N |
| XLogP | 4.32 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|