C25H32O7 — CID 127028675
(1R,10R,13S)-13-decanoyl-5-[(2S)-2-hydroxypropyl]-10-methyl-4,11,14-trioxatetracyclo[8.4.0.01,13.02,7]tetradeca-2,5,7-triene-9,12-dione (PubChem CID 127028675) has the molecular formula C25H32O7 and a molecular weight of 444.52 g/mol. Its IUPAC name is (1R,10R,13S)-13-decanoyl-5-[(2S)-2-hydroxypropyl]-10-methyl-4,11,14-trioxatetracyclo[8.4.0.01,13.02,7]tetradeca-2,5,7-triene-9,12-dione.
| Compound Name | (1R,10R,13S)-13-decanoyl-5-[(2S)-2-hydroxypropyl]-10-methyl-4,11,14-trioxatetracyclo[8.4.0.01,13.02,7]tetradeca-2,5,7-triene-9,12-dione |
|---|---|
| PubChem CID | 127028675 |
| Molecular Formula | C25H32O7 |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | (1R,10R,13S)-13-decanoyl-5-[(2S)-2-hydroxypropyl]-10-methyl-4,11,14-trioxatetracyclo[8.4.0.01,13.02,7]tetradeca-2,5,7-triene-9,12-dione |
| SMILES | CCCCCCCCCC(=O)[C@@]12O[C@@]13C1=COC(C[C@H](C)O)=CC1=CC(=O)[C@]3(C)OC2=O |
| InChI | InChI=1S/C25H32O7/c1-4-5-6-7-8-9-10-11-20(27)24-22(29)31-23(3)21(28)14-17-13-18(12-16(2)26)30-15-19(17)25(23,24)32-24/h13-16,26H,4-12H2,1-3H3/t16-,23-,24-,25+/m0/s1 |
| InChIKey | YEGUZQUADBNQFP-NBQXJWNKSA-N |
| XLogP | 3.60 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|