About 2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-(2-phenylethyl)acetamide
2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-(2-phenylethyl)acetamide (PubChem CID 127028737) has the molecular formula C22H21Cl2N3O2
and a molecular weight of 430.34 g/mol. Its IUPAC name is 2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-(2-phenylethyl)acetamide.
Molecular Properties
| Compound Name | 2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-(2-phenylethyl)acetamide |
| PubChem CID | 127028737 |
| Molecular Formula | C22H21Cl2N3O2 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-(2-phenylethyl)acetamide |
| SMILES | O=C(Cn1cccc(NCc2ccc(Cl)c(Cl)c2)c1=O)NCCc1ccccc1 |
| InChI | InChI=1S/C22H21Cl2N3O2/c23-18-9-8-17(13-19(18)24)14-26-20-7-4-12-27(22(20)29)15-21(28)25-11-10-16-5-2-1-3-6-16/h1-9,12-13,26H,10-11,14-15H2,(H,25,28) |
| InChIKey | LKCFLVOVENFJOI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-(2-phenylethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-(2-phenylethyl)acetamide?
The IUPAC name of 2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-(2-phenylethyl)acetamide (CID 127028737) is 2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-(2-phenylethyl)acetamide.
What is the SMILES notation for 2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-(2-phenylethyl)acetamide?
The canonical SMILES for 2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-(2-phenylethyl)acetamide is O=C(Cn1cccc(NCc2ccc(Cl)c(Cl)c2)c1=O)NCCc1ccccc1.
What is the InChIKey of 2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-(2-phenylethyl)acetamide?
The InChIKey is LKCFLVOVENFJOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21Cl2N3O2/c23-18-9-8-17(13-19(18)24)14-26-20-7-4-12-27(22(20)29)15-21(28)25-11-10-16-5-2-1-3-6-16/h1-9,12-13,26H,10-11,14-15H2,(H,25,28).
What are the key properties of 2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-(2-phenylethyl)acetamide?
2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-(2-phenylethyl)acetamide has a molecular weight of 430.34 g/mol, XLogP of 4.13, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-(2-phenylethyl)acetamide is sourced from PubChem (CID 127028737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).