C22H19BrO5 — CID 127028907
(2E,6E)-2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-6-[(4-hydroxy-3-methoxyphenyl)methylidene]cyclohexan-1-one (PubChem CID 127028907) has the molecular formula C22H19BrO5 and a molecular weight of 443.29 g/mol. Its IUPAC name is (2E,6E)-2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-6-[(4-hydroxy-3-methoxyphenyl)methylidene]cyclohexan-1-one.
| Compound Name | (2E,6E)-2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-6-[(4-hydroxy-3-methoxyphenyl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 127028907 |
| Molecular Formula | C22H19BrO5 |
| Molecular Weight | 443.29 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | (2E,6E)-2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-6-[(4-hydroxy-3-methoxyphenyl)methylidene]cyclohexan-1-one |
| SMILES | COc1cc(/C=C2\CCC/C(=C\c3cc4c(cc3Br)OCO4)C2=O)ccc1O |
| InChI | InChI=1S/C22H19BrO5/c1-26-19-8-13(5-6-18(19)24)7-14-3-2-4-15(22(14)25)9-16-10-20-21(11-17(16)23)28-12-27-20/h5-11,24H,2-4,12H2,1H3/b14-7+,15-9+ |
| InChIKey | ZVFOSCOMPXTCTE-YQRBWYBHSA-N |
| XLogP | 5.11 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.29 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|