About 4-(dimethylamino)-1,1-bis(2-methoxyquinolin-3-yl)-2-phenylbutan-2-ol
4-(dimethylamino)-1,1-bis(2-methoxyquinolin-3-yl)-2-phenylbutan-2-ol (PubChem CID 127028921) has the molecular formula C32H33N3O3
and a molecular weight of 507.63 g/mol. Its IUPAC name is 4-(dimethylamino)-1,1-bis(2-methoxyquinolin-3-yl)-2-phenylbutan-2-ol.
Molecular Properties
| Compound Name | 4-(dimethylamino)-1,1-bis(2-methoxyquinolin-3-yl)-2-phenylbutan-2-ol |
| PubChem CID | 127028921 |
| Molecular Formula | C32H33N3O3 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | 4-(dimethylamino)-1,1-bis(2-methoxyquinolin-3-yl)-2-phenylbutan-2-ol |
| SMILES | COc1nc2ccccc2cc1C(c1cc2ccccc2nc1OC)C(O)(CCN(C)C)c1ccccc1 |
| InChI | InChI=1S/C32H33N3O3/c1-35(2)19-18-32(36,24-14-6-5-7-15-24)29(25-20-22-12-8-10-16-27(22)33-30(25)37-3)26-21-23-13-9-11-17-28(23)34-31(26)38-4/h5-17,20-21,29,36H,18-19H2,1-4H3 |
| InChIKey | QXQOBCBJOCQFRK-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(dimethylamino)-1,1-bis(2-methoxyquinolin-3-yl)-2-phenylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)-1,1-bis(2-methoxyquinolin-3-yl)-2-phenylbutan-2-ol?
The IUPAC name of 4-(dimethylamino)-1,1-bis(2-methoxyquinolin-3-yl)-2-phenylbutan-2-ol (CID 127028921) is 4-(dimethylamino)-1,1-bis(2-methoxyquinolin-3-yl)-2-phenylbutan-2-ol.
What is the SMILES notation for 4-(dimethylamino)-1,1-bis(2-methoxyquinolin-3-yl)-2-phenylbutan-2-ol?
The canonical SMILES for 4-(dimethylamino)-1,1-bis(2-methoxyquinolin-3-yl)-2-phenylbutan-2-ol is COc1nc2ccccc2cc1C(c1cc2ccccc2nc1OC)C(O)(CCN(C)C)c1ccccc1.
What is the InChIKey of 4-(dimethylamino)-1,1-bis(2-methoxyquinolin-3-yl)-2-phenylbutan-2-ol?
The InChIKey is QXQOBCBJOCQFRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H33N3O3/c1-35(2)19-18-32(36,24-14-6-5-7-15-24)29(25-20-22-12-8-10-16-27(22)33-30(25)37-3)26-21-23-13-9-11-17-28(23)34-31(26)38-4/h5-17,20-21,29,36H,18-19H2,1-4H3.
What are the key properties of 4-(dimethylamino)-1,1-bis(2-methoxyquinolin-3-yl)-2-phenylbutan-2-ol?
4-(dimethylamino)-1,1-bis(2-methoxyquinolin-3-yl)-2-phenylbutan-2-ol has a molecular weight of 507.63 g/mol, XLogP of 5.77, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)-1,1-bis(2-methoxyquinolin-3-yl)-2-phenylbutan-2-ol is sourced from PubChem (CID 127028921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).