About [2-(2,3-difluoro-6-prop-2-enoxyphenyl)cyclopropyl]methanamine;hydrochloride
[2-(2,3-difluoro-6-prop-2-enoxyphenyl)cyclopropyl]methanamine;hydrochloride (PubChem CID 127029036) has the molecular formula C13H16ClF2NO
and a molecular weight of 275.73 g/mol. Its IUPAC name is [2-(2,3-difluoro-6-prop-2-enoxyphenyl)cyclopropyl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [2-(2,3-difluoro-6-prop-2-enoxyphenyl)cyclopropyl]methanamine;hydrochloride |
| PubChem CID | 127029036 |
| Molecular Formula | C13H16ClF2NO |
| Molecular Weight | 275.73 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | [2-(2,3-difluoro-6-prop-2-enoxyphenyl)cyclopropyl]methanamine;hydrochloride |
| SMILES | C=CCOc1ccc(F)c(F)c1C1CC1CN.Cl |
| InChI | InChI=1S/C13H15F2NO.ClH/c1-2-5-17-11-4-3-10(14)13(15)12(11)9-6-8(9)7-16;/h2-4,8-9H,1,5-7,16H2;1H |
| InChIKey | YASCELUJQFTHGR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.73 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,3-difluoro-6-prop-2-enoxyphenyl)cyclopropyl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,3-difluoro-6-prop-2-enoxyphenyl)cyclopropyl]methanamine;hydrochloride?
The IUPAC name of [2-(2,3-difluoro-6-prop-2-enoxyphenyl)cyclopropyl]methanamine;hydrochloride (CID 127029036) is [2-(2,3-difluoro-6-prop-2-enoxyphenyl)cyclopropyl]methanamine;hydrochloride.
What is the SMILES notation for [2-(2,3-difluoro-6-prop-2-enoxyphenyl)cyclopropyl]methanamine;hydrochloride?
The canonical SMILES for [2-(2,3-difluoro-6-prop-2-enoxyphenyl)cyclopropyl]methanamine;hydrochloride is C=CCOc1ccc(F)c(F)c1C1CC1CN.Cl.
What is the InChIKey of [2-(2,3-difluoro-6-prop-2-enoxyphenyl)cyclopropyl]methanamine;hydrochloride?
The InChIKey is YASCELUJQFTHGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F2NO.ClH/c1-2-5-17-11-4-3-10(14)13(15)12(11)9-6-8(9)7-16;/h2-4,8-9H,1,5-7,16H2;1H.
What are the key properties of [2-(2,3-difluoro-6-prop-2-enoxyphenyl)cyclopropyl]methanamine;hydrochloride?
[2-(2,3-difluoro-6-prop-2-enoxyphenyl)cyclopropyl]methanamine;hydrochloride has a molecular weight of 275.73 g/mol, XLogP of 3.01, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,3-difluoro-6-prop-2-enoxyphenyl)cyclopropyl]methanamine;hydrochloride is sourced from PubChem (CID 127029036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).