About N-benzyl-2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]acetamide
N-benzyl-2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]acetamide (PubChem CID 127029041) has the molecular formula C21H19Cl2N3O2
and a molecular weight of 416.31 g/mol. Its IUPAC name is N-benzyl-2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]acetamide.
Molecular Properties
| Compound Name | N-benzyl-2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]acetamide |
| PubChem CID | 127029041 |
| Molecular Formula | C21H19Cl2N3O2 |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | N-benzyl-2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]acetamide |
| SMILES | O=C(Cn1cccc(NCc2ccc(Cl)c(Cl)c2)c1=O)NCc1ccccc1 |
| InChI | InChI=1S/C21H19Cl2N3O2/c22-17-9-8-16(11-18(17)23)13-24-19-7-4-10-26(21(19)28)14-20(27)25-12-15-5-2-1-3-6-15/h1-11,24H,12-14H2,(H,25,27) |
| InChIKey | SBUPRSNOKJTUNX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-benzyl-2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]acetamide?
The IUPAC name of N-benzyl-2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]acetamide (CID 127029041) is N-benzyl-2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]acetamide.
What is the SMILES notation for N-benzyl-2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]acetamide?
The canonical SMILES for N-benzyl-2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]acetamide is O=C(Cn1cccc(NCc2ccc(Cl)c(Cl)c2)c1=O)NCc1ccccc1.
What is the InChIKey of N-benzyl-2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]acetamide?
The InChIKey is SBUPRSNOKJTUNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19Cl2N3O2/c22-17-9-8-16(11-18(17)23)13-24-19-7-4-10-26(21(19)28)14-20(27)25-12-15-5-2-1-3-6-15/h1-11,24H,12-14H2,(H,25,27).
What are the key properties of N-benzyl-2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]acetamide?
N-benzyl-2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]acetamide has a molecular weight of 416.31 g/mol, XLogP of 4.08, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]acetamide is sourced from PubChem (CID 127029041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).