About 2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-propylacetamide
2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-propylacetamide (PubChem CID 127029042) has the molecular formula C17H19Cl2N3O2
and a molecular weight of 368.26 g/mol. Its IUPAC name is 2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-propylacetamide.
Molecular Properties
| Compound Name | 2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-propylacetamide |
| PubChem CID | 127029042 |
| Molecular Formula | C17H19Cl2N3O2 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-propylacetamide |
| SMILES | CCCNC(=O)Cn1cccc(NCc2ccc(Cl)c(Cl)c2)c1=O |
| InChI | InChI=1S/C17H19Cl2N3O2/c1-2-7-20-16(23)11-22-8-3-4-15(17(22)24)21-10-12-5-6-13(18)14(19)9-12/h3-6,8-9,21H,2,7,10-11H2,1H3,(H,20,23) |
| InChIKey | LESDOUYKHVFDCZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-propylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-propylacetamide?
The IUPAC name of 2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-propylacetamide (CID 127029042) is 2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-propylacetamide.
What is the SMILES notation for 2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-propylacetamide?
The canonical SMILES for 2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-propylacetamide is CCCNC(=O)Cn1cccc(NCc2ccc(Cl)c(Cl)c2)c1=O.
What is the InChIKey of 2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-propylacetamide?
The InChIKey is LESDOUYKHVFDCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19Cl2N3O2/c1-2-7-20-16(23)11-22-8-3-4-15(17(22)24)21-10-12-5-6-13(18)14(19)9-12/h3-6,8-9,21H,2,7,10-11H2,1H3,(H,20,23).
What are the key properties of 2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-propylacetamide?
2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-propylacetamide has a molecular weight of 368.26 g/mol, XLogP of 3.29, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[(3,4-dichlorophenyl)methylamino]-2-oxo-1-pyridinyl]-N-propylacetamide is sourced from PubChem (CID 127029042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).