C31H22O8 — CID 127029186
1-(2,6-dihydroxy-5,7-dimethoxyphenanthren-1-yl)-7-hydroxy-2-methoxyphenanthrene-3,4-dione (PubChem CID 127029186) has the molecular formula C31H22O8 and a molecular weight of 522.51 g/mol. Its IUPAC name is 1-(2,6-dihydroxy-5,7-dimethoxyphenanthren-1-yl)-7-hydroxy-2-methoxyphenanthrene-3,4-dione.
| Compound Name | 1-(2,6-dihydroxy-5,7-dimethoxyphenanthren-1-yl)-7-hydroxy-2-methoxyphenanthrene-3,4-dione |
|---|---|
| PubChem CID | 127029186 |
| Molecular Formula | C31H22O8 |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | 1-(2,6-dihydroxy-5,7-dimethoxyphenanthren-1-yl)-7-hydroxy-2-methoxyphenanthrene-3,4-dione |
| SMILES | COC1=C(c2c(O)ccc3c2ccc2cc(OC)c(O)c(OC)c23)c2ccc3cc(O)ccc3c2C(=O)C1=O |
| InChI | InChI=1S/C31H22O8/c1-37-22-13-15-5-7-19-18(23(15)30(38-2)27(22)34)10-11-21(33)25(19)26-20-8-4-14-12-16(32)6-9-17(14)24(20)28(35)29(36)31(26)39-3/h4-13,32-34H,1-3H3 |
| InChIKey | XHTGGPUDVVNVBH-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|