C20H19NO5 — CID 127029193
(Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile (PubChem CID 127029193) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is (Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 127029193 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1cc(/C(C#N)=C/c2ccc3c(c2)OCCO3)cc(OC)c1OC |
| InChI | InChI=1S/C20H19NO5/c1-22-18-10-14(11-19(23-2)20(18)24-3)15(12-21)8-13-4-5-16-17(9-13)26-7-6-25-16/h4-5,8-11H,6-7H2,1-3H3/b15-8+ |
| InChIKey | LYTRPUZXLFZSPO-OVCLIPMQSA-N |
| XLogP | 3.55 |
| TPSA | 69.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|