C17H22N4O2S — CID 127029269
S-[6-[(3-pyridin-4-yl-1H-pyrazole-5-carbonyl)amino]hexyl] ethanethioate (PubChem CID 127029269) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is S-[6-[(3-pyridin-4-yl-1H-pyrazole-5-carbonyl)amino]hexyl] ethanethioate.
| Compound Name | S-[6-[(3-pyridin-4-yl-1H-pyrazole-5-carbonyl)amino]hexyl] ethanethioate |
|---|---|
| PubChem CID | 127029269 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | S-[6-[(3-pyridin-4-yl-1H-pyrazole-5-carbonyl)amino]hexyl] ethanethioate |
| SMILES | CC(=O)SCCCCCCNC(=O)c1cc(-c2ccncc2)n[nH]1 |
| InChI | InChI=1S/C17H22N4O2S/c1-13(22)24-11-5-3-2-4-8-19-17(23)16-12-15(20-21-16)14-6-9-18-10-7-14/h6-7,9-10,12H,2-5,8,11H2,1H3,(H,19,23)(H,20,21) |
| InChIKey | HKZMALLSZQIZBC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|