C19H26N4O2S — CID 127029271
S-[6-[(3-pyridin-4-yl-1H-pyrazole-5-carbonyl)amino]hexyl] butanethioate (PubChem CID 127029271) has the molecular formula C19H26N4O2S and a molecular weight of 374.51 g/mol. Its IUPAC name is S-[6-[(3-pyridin-4-yl-1H-pyrazole-5-carbonyl)amino]hexyl] butanethioate.
| Compound Name | S-[6-[(3-pyridin-4-yl-1H-pyrazole-5-carbonyl)amino]hexyl] butanethioate |
|---|---|
| PubChem CID | 127029271 |
| Molecular Formula | C19H26N4O2S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | S-[6-[(3-pyridin-4-yl-1H-pyrazole-5-carbonyl)amino]hexyl] butanethioate |
| SMILES | CCCC(=O)SCCCCCCNC(=O)c1cc(-c2ccncc2)n[nH]1 |
| InChI | InChI=1S/C19H26N4O2S/c1-2-7-18(24)26-13-6-4-3-5-10-21-19(25)17-14-16(22-23-17)15-8-11-20-12-9-15/h8-9,11-12,14H,2-7,10,13H2,1H3,(H,21,25)(H,22,23) |
| InChIKey | FFGOOPSVOPLXMB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|