C27H52N2O7 — CID 127029288
1-[2-(decylamino)ethylamino]-3-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]propan-2-ol (PubChem CID 127029288) has the molecular formula C27H52N2O7 and a molecular weight of 516.72 g/mol. Its IUPAC name is 1-[2-(decylamino)ethylamino]-3-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]propan-2-ol.
| Compound Name | 1-[2-(decylamino)ethylamino]-3-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]propan-2-ol |
|---|---|
| PubChem CID | 127029288 |
| Molecular Formula | C27H52N2O7 |
| Molecular Weight | 516.72 g/mol |
| Exact Mass | 516.38 |
| IUPAC Name | 1-[2-(decylamino)ethylamino]-3-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]propan-2-ol |
| SMILES | CCCCCCCCCCNCCNCC(O)COC[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C27H52N2O7/c1-6-7-8-9-10-11-12-13-14-28-15-16-29-17-20(30)18-31-19-21-22-23(34-26(2,3)33-22)24-25(32-21)36-27(4,5)35-24/h20-25,28-30H,6-19H2,1-5H3/t20?,21-,22+,23+,24-,25-/m1/s1 |
| InChIKey | IIXWYECDZUVLDO-BPVAZVPSSA-N |
| XLogP | 3.08 |
| TPSA | 99.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.72 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|