C33H40ClN3O5S2 — CID 127029447
9-benzyl-3-methylidene-1-(4-methylphenyl)sulfonyl-5-(4-prop-2-ynoxyphenyl)sulfonyl-1,5,9-triazacyclododecane;hydrochloride (PubChem CID 127029447) has the molecular formula C33H40ClN3O5S2 and a molecular weight of 658.29 g/mol. Its IUPAC name is 9-benzyl-3-methylidene-1-(4-methylphenyl)sulfonyl-5-(4-prop-2-ynoxyphenyl)sulfonyl-1,5,9-triazacyclododecane;hydrochloride.
| Compound Name | 9-benzyl-3-methylidene-1-(4-methylphenyl)sulfonyl-5-(4-prop-2-ynoxyphenyl)sulfonyl-1,5,9-triazacyclododecane;hydrochloride |
|---|---|
| PubChem CID | 127029447 |
| Molecular Formula | C33H40ClN3O5S2 |
| Molecular Weight | 658.29 g/mol |
| Exact Mass | 657.21 |
| IUPAC Name | 9-benzyl-3-methylidene-1-(4-methylphenyl)sulfonyl-5-(4-prop-2-ynoxyphenyl)sulfonyl-1,5,9-triazacyclododecane;hydrochloride |
| SMILES | C#CCOc1ccc(S(=O)(=O)N2CCCN(Cc3ccccc3)CCCN(S(=O)(=O)c3ccc(C)cc3)CC(=C)C2)cc1.Cl |
| InChI | InChI=1S/C33H39N3O5S2.ClH/c1-4-24-41-31-14-18-33(19-15-31)43(39,40)36-23-9-21-34(27-30-10-6-5-7-11-30)20-8-22-35(25-29(3)26-36)42(37,38)32-16-12-28(2)13-17-32;/h1,5-7,10-19H,3,8-9,20-27H2,2H3;1H |
| InChIKey | VAKQSUZCJQXSPA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.29 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|