C25H38O3 — CID 127029708
2,2,4,4-tetramethyl-9-(4-methylpent-3-enyl)-11-(2-methylpropyl)spiro[5.5]undec-8-ene-1,3,5-trione (PubChem CID 127029708) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-9-(4-methylpent-3-enyl)-11-(2-methylpropyl)spiro[5.5]undec-8-ene-1,3,5-trione.
| Compound Name | 2,2,4,4-tetramethyl-9-(4-methylpent-3-enyl)-11-(2-methylpropyl)spiro[5.5]undec-8-ene-1,3,5-trione |
|---|---|
| PubChem CID | 127029708 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | 2,2,4,4-tetramethyl-9-(4-methylpent-3-enyl)-11-(2-methylpropyl)spiro[5.5]undec-8-ene-1,3,5-trione |
| SMILES | CC(C)=CCCC1=CCC2(C(=O)C(C)(C)C(=O)C(C)(C)C2=O)C(CC(C)C)C1 |
| InChI | InChI=1S/C25H38O3/c1-16(2)10-9-11-18-12-13-25(19(15-18)14-17(3)4)21(27)23(5,6)20(26)24(7,8)22(25)28/h10,12,17,19H,9,11,13-15H2,1-8H3 |
| InChIKey | TWGHLFMURTVYAB-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|