C41H52N4O7S2 — CID 127029719
2-[3-[4-[[9-(cyclohexylmethyl)-3-methylidene-5-(4-methylphenyl)sulfonyl-1,5,9-triazacyclododec-1-yl]sulfonyl]phenoxy]propyl]isoindole-1,3-dione (PubChem CID 127029719) has the molecular formula C41H52N4O7S2 and a molecular weight of 777.02 g/mol. Its IUPAC name is 2-[3-[4-[[9-(cyclohexylmethyl)-3-methylidene-5-(4-methylphenyl)sulfonyl-1,5,9-triazacyclododec-1-yl]sulfonyl]phenoxy]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[4-[[9-(cyclohexylmethyl)-3-methylidene-5-(4-methylphenyl)sulfonyl-1,5,9-triazacyclododec-1-yl]sulfonyl]phenoxy]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 127029719 |
| Molecular Formula | C41H52N4O7S2 |
| Molecular Weight | 777.02 g/mol |
| Exact Mass | 776.33 |
| IUPAC Name | 2-[3-[4-[[9-(cyclohexylmethyl)-3-methylidene-5-(4-methylphenyl)sulfonyl-1,5,9-triazacyclododec-1-yl]sulfonyl]phenoxy]propyl]isoindole-1,3-dione |
| SMILES | C=C1CN(S(=O)(=O)c2ccc(C)cc2)CCCN(CC2CCCCC2)CCCN(S(=O)(=O)c2ccc(OCCCN3C(=O)c4ccccc4C3=O)cc2)C1 |
| InChI | InChI=1S/C41H52N4O7S2/c1-32-15-19-36(20-16-32)53(48,49)43-25-8-23-42(31-34-11-4-3-5-12-34)24-9-26-44(30-33(2)29-43)54(50,51)37-21-17-35(18-22-37)52-28-10-27-45-40(46)38-13-6-7-14-39(38)41(45)47/h6-7,13-22,34H,2-5,8-12,23-31H2,1H3 |
| InChIKey | RIGAGPZDMSFASX-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 124.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.02 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|