C31H37ClN4O5S — CID 127029739
[9-benzyl-3-methylidene-5-(4-methylphenyl)sulfonyl-1,5,9-triazacyclododec-1-yl]-(4-nitrophenyl)methanone;hydrochloride (PubChem CID 127029739) has the molecular formula C31H37ClN4O5S and a molecular weight of 613.18 g/mol. Its IUPAC name is [9-benzyl-3-methylidene-5-(4-methylphenyl)sulfonyl-1,5,9-triazacyclododec-1-yl]-(4-nitrophenyl)methanone;hydrochloride.
| Compound Name | [9-benzyl-3-methylidene-5-(4-methylphenyl)sulfonyl-1,5,9-triazacyclododec-1-yl]-(4-nitrophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 127029739 |
| Molecular Formula | C31H37ClN4O5S |
| Molecular Weight | 613.18 g/mol |
| Exact Mass | 612.22 |
| IUPAC Name | [9-benzyl-3-methylidene-5-(4-methylphenyl)sulfonyl-1,5,9-triazacyclododec-1-yl]-(4-nitrophenyl)methanone;hydrochloride |
| SMILES | C=C1CN(C(=O)c2ccc([N+](=O)[O-])cc2)CCCN(Cc2ccccc2)CCCN(S(=O)(=O)c2ccc(C)cc2)C1.Cl |
| InChI | InChI=1S/C31H36N4O5S.ClH/c1-25-10-16-30(17-11-25)41(39,40)34-21-7-19-32(24-27-8-4-3-5-9-27)18-6-20-33(22-26(2)23-34)31(36)28-12-14-29(15-13-28)35(37)38;/h3-5,8-17H,2,6-7,18-24H2,1H3;1H |
| InChIKey | XIMOXWGSQYUGAX-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.18 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|