C25H22N2O6 — CID 127029926
N-(1-azabicyclo[2.2.2]octan-3-yl)-4,11-dihydroxy-2-methyl-5,10-dioxonaphtho[2,3-f][1]benzofuran-3-carboxamide (PubChem CID 127029926) has the molecular formula C25H22N2O6 and a molecular weight of 446.46 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.2]octan-3-yl)-4,11-dihydroxy-2-methyl-5,10-dioxonaphtho[2,3-f][1]benzofuran-3-carboxamide.
| Compound Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-4,11-dihydroxy-2-methyl-5,10-dioxonaphtho[2,3-f][1]benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 127029926 |
| Molecular Formula | C25H22N2O6 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-4,11-dihydroxy-2-methyl-5,10-dioxonaphtho[2,3-f][1]benzofuran-3-carboxamide |
| SMILES | Cc1oc2c(O)c3c(c(O)c2c1C(=O)NC1CN2CCC1CC2)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C25H22N2O6/c1-11-16(25(32)26-15-10-27-8-6-12(15)7-9-27)19-22(30)17-18(23(31)24(19)33-11)21(29)14-5-3-2-4-13(14)20(17)28/h2-5,12,15,30-31H,6-10H2,1H3,(H,26,32) |
| InChIKey | TVDCORARCMUJOG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|