About N,N-diethylacetamide
N,N-diethylacetamide (PubChem CID 12703) has the molecular formula C6H13NO
and a molecular weight of 115.18 g/mol. Its IUPAC name is N,N-diethylacetamide.
Molecular Properties
| Compound Name | N,N-diethylacetamide |
| PubChem CID | 12703 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | N,N-diethylacetamide |
| SMILES | CCN(CC)C(C)=O |
| InChI | InChI=1S/C6H13NO/c1-4-7(5-2)6(3)8/h4-5H2,1-3H3 |
| InChIKey | AJFDBNQQDYLMJN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-diethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylacetamide?
The IUPAC name of N,N-diethylacetamide (CID 12703) is N,N-diethylacetamide.
What is the SMILES notation for N,N-diethylacetamide?
The canonical SMILES for N,N-diethylacetamide is CCN(CC)C(C)=O.
What is the InChIKey of N,N-diethylacetamide?
The InChIKey is AJFDBNQQDYLMJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO/c1-4-7(5-2)6(3)8/h4-5H2,1-3H3.
What are the key properties of N,N-diethylacetamide?
N,N-diethylacetamide has a molecular weight of 115.18 g/mol, XLogP of 0.87, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylacetamide is sourced from PubChem (CID 12703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).