About [1-(1H-pyrrolo[2,3-b]pyridin-3-yl)triazol-4-yl]methanol
[1-(1H-pyrrolo[2,3-b]pyridin-3-yl)triazol-4-yl]methanol (PubChem CID 127030003) has the molecular formula C10H9N5O
and a molecular weight of 215.22 g/mol. Its IUPAC name is [1-(1H-pyrrolo[2,3-b]pyridin-3-yl)triazol-4-yl]methanol.
Molecular Properties
| Compound Name | [1-(1H-pyrrolo[2,3-b]pyridin-3-yl)triazol-4-yl]methanol |
| PubChem CID | 127030003 |
| Molecular Formula | C10H9N5O |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | [1-(1H-pyrrolo[2,3-b]pyridin-3-yl)triazol-4-yl]methanol |
| SMILES | OCc1cn(-c2c[nH]c3ncccc23)nn1 |
| InChI | InChI=1S/C10H9N5O/c16-6-7-5-15(14-13-7)9-4-12-10-8(9)2-1-3-11-10/h1-5,16H,6H2,(H,11,12) |
| InChIKey | WKGQJAVSXXZSBU-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(1H-pyrrolo[2,3-b]pyridin-3-yl)triazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1H-pyrrolo[2,3-b]pyridin-3-yl)triazol-4-yl]methanol?
The IUPAC name of [1-(1H-pyrrolo[2,3-b]pyridin-3-yl)triazol-4-yl]methanol (CID 127030003) is [1-(1H-pyrrolo[2,3-b]pyridin-3-yl)triazol-4-yl]methanol.
What is the SMILES notation for [1-(1H-pyrrolo[2,3-b]pyridin-3-yl)triazol-4-yl]methanol?
The canonical SMILES for [1-(1H-pyrrolo[2,3-b]pyridin-3-yl)triazol-4-yl]methanol is OCc1cn(-c2c[nH]c3ncccc23)nn1.
What is the InChIKey of [1-(1H-pyrrolo[2,3-b]pyridin-3-yl)triazol-4-yl]methanol?
The InChIKey is WKGQJAVSXXZSBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N5O/c16-6-7-5-15(14-13-7)9-4-12-10-8(9)2-1-3-11-10/h1-5,16H,6H2,(H,11,12).
What are the key properties of [1-(1H-pyrrolo[2,3-b]pyridin-3-yl)triazol-4-yl]methanol?
[1-(1H-pyrrolo[2,3-b]pyridin-3-yl)triazol-4-yl]methanol has a molecular weight of 215.22 g/mol, XLogP of 0.64, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1H-pyrrolo[2,3-b]pyridin-3-yl)triazol-4-yl]methanol is sourced from PubChem (CID 127030003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).