C26H27FN4O — CID 127030232
(1R,3R)-3-[4-(4-fluorophenyl)-1-methylimidazol-2-yl]-1-(oxan-4-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 127030232) has the molecular formula C26H27FN4O and a molecular weight of 430.53 g/mol. Its IUPAC name is (1R,3R)-3-[4-(4-fluorophenyl)-1-methylimidazol-2-yl]-1-(oxan-4-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | (1R,3R)-3-[4-(4-fluorophenyl)-1-methylimidazol-2-yl]-1-(oxan-4-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 127030232 |
| Molecular Formula | C26H27FN4O |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | (1R,3R)-3-[4-(4-fluorophenyl)-1-methylimidazol-2-yl]-1-(oxan-4-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | Cn1cc(-c2ccc(F)cc2)nc1[C@H]1Cc2c([nH]c3ccccc23)[C@@H](C2CCOCC2)N1 |
| InChI | InChI=1S/C26H27FN4O/c1-31-15-23(16-6-8-18(27)9-7-16)30-26(31)22-14-20-19-4-2-3-5-21(19)28-25(20)24(29-22)17-10-12-32-13-11-17/h2-9,15,17,22,24,28-29H,10-14H2,1H3/t22-,24-/m1/s1 |
| InChIKey | VXIPNVNAURJKTO-ISKFKSNPSA-N |
| XLogP | 5.06 |
| TPSA | 54.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|