About methyl 4-[(2,5-difluoro-N-(4-fluorophenyl)sulfonylanilino)methyl]benzoate
methyl 4-[(2,5-difluoro-N-(4-fluorophenyl)sulfonylanilino)methyl]benzoate (PubChem CID 127030331) has the molecular formula C21H16F3NO4S
and a molecular weight of 435.42 g/mol. Its IUPAC name is methyl 4-[(2,5-difluoro-N-(4-fluorophenyl)sulfonylanilino)methyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[(2,5-difluoro-N-(4-fluorophenyl)sulfonylanilino)methyl]benzoate |
| PubChem CID | 127030331 |
| Molecular Formula | C21H16F3NO4S |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | methyl 4-[(2,5-difluoro-N-(4-fluorophenyl)sulfonylanilino)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(c2cc(F)ccc2F)S(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H16F3NO4S/c1-29-21(26)15-4-2-14(3-5-15)13-25(20-12-17(23)8-11-19(20)24)30(27,28)18-9-6-16(22)7-10-18/h2-12H,13H2,1H3 |
| InChIKey | NIAFKLUKSJLVNF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-[(2,5-difluoro-N-(4-fluorophenyl)sulfonylanilino)methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(2,5-difluoro-N-(4-fluorophenyl)sulfonylanilino)methyl]benzoate?
The IUPAC name of methyl 4-[(2,5-difluoro-N-(4-fluorophenyl)sulfonylanilino)methyl]benzoate (CID 127030331) is methyl 4-[(2,5-difluoro-N-(4-fluorophenyl)sulfonylanilino)methyl]benzoate.
What is the SMILES notation for methyl 4-[(2,5-difluoro-N-(4-fluorophenyl)sulfonylanilino)methyl]benzoate?
The canonical SMILES for methyl 4-[(2,5-difluoro-N-(4-fluorophenyl)sulfonylanilino)methyl]benzoate is COC(=O)c1ccc(CN(c2cc(F)ccc2F)S(=O)(=O)c2ccc(F)cc2)cc1.
What is the InChIKey of methyl 4-[(2,5-difluoro-N-(4-fluorophenyl)sulfonylanilino)methyl]benzoate?
The InChIKey is NIAFKLUKSJLVNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16F3NO4S/c1-29-21(26)15-4-2-14(3-5-15)13-25(20-12-17(23)8-11-19(20)24)30(27,28)18-9-6-16(22)7-10-18/h2-12H,13H2,1H3.
What are the key properties of methyl 4-[(2,5-difluoro-N-(4-fluorophenyl)sulfonylanilino)methyl]benzoate?
methyl 4-[(2,5-difluoro-N-(4-fluorophenyl)sulfonylanilino)methyl]benzoate has a molecular weight of 435.42 g/mol, XLogP of 4.29, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(2,5-difluoro-N-(4-fluorophenyl)sulfonylanilino)methyl]benzoate is sourced from PubChem (CID 127030331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).