C21H23N3O3 — CID 127030352
benzyl 4-[(2,7-dimethylimidazo[1,2-a]pyridine-3-carbonyl)amino]butanoate (PubChem CID 127030352) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is benzyl 4-[(2,7-dimethylimidazo[1,2-a]pyridine-3-carbonyl)amino]butanoate.
| Compound Name | benzyl 4-[(2,7-dimethylimidazo[1,2-a]pyridine-3-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 127030352 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | benzyl 4-[(2,7-dimethylimidazo[1,2-a]pyridine-3-carbonyl)amino]butanoate |
| SMILES | Cc1ccn2c(C(=O)NCCCC(=O)OCc3ccccc3)c(C)nc2c1 |
| InChI | InChI=1S/C21H23N3O3/c1-15-10-12-24-18(13-15)23-16(2)20(24)21(26)22-11-6-9-19(25)27-14-17-7-4-3-5-8-17/h3-5,7-8,10,12-13H,6,9,11,14H2,1-2H3,(H,22,26) |
| InChIKey | FOBAURJYHZZLNK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|