C22H24N2O3 — CID 127030472
methyl (1R,9R,16R,18R,21S)-14-formyl-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7,13-tetraene-18-carboxylate (PubChem CID 127030472) has the molecular formula C22H24N2O3 and a molecular weight of 364.44 g/mol. Its IUPAC name is methyl (1R,9R,16R,18R,21S)-14-formyl-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7,13-tetraene-18-carboxylate.
| Compound Name | methyl (1R,9R,16R,18R,21S)-14-formyl-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7,13-tetraene-18-carboxylate |
|---|---|
| PubChem CID | 127030472 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | methyl (1R,9R,16R,18R,21S)-14-formyl-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7,13-tetraene-18-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@]23CC[C@@]14Nc1ccccc1[C@@]41CCN(C=C(C=O)C2)[C@@H]31 |
| InChI | InChI=1S/C22H24N2O3/c1-27-18(26)16-11-20-6-7-22(16)21(15-4-2-3-5-17(15)23-22)8-9-24(19(20)21)12-14(10-20)13-25/h2-5,12-13,16,19,23H,6-11H2,1H3/t16-,19-,20-,21+,22+/m0/s1 |
| InChIKey | KPKZPYKXSWFRKN-XXGVUKKKSA-N |
| XLogP | 2.62 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|