C26H25F3N4O2 — CID 127030530
(1R,3R)-1-(oxan-4-yl)-3-[5-[4-(trifluoromethoxy)phenyl]-1H-imidazol-2-yl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 127030530) has the molecular formula C26H25F3N4O2 and a molecular weight of 482.51 g/mol. Its IUPAC name is (1R,3R)-1-(oxan-4-yl)-3-[5-[4-(trifluoromethoxy)phenyl]-1H-imidazol-2-yl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | (1R,3R)-1-(oxan-4-yl)-3-[5-[4-(trifluoromethoxy)phenyl]-1H-imidazol-2-yl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 127030530 |
| Molecular Formula | C26H25F3N4O2 |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | (1R,3R)-1-(oxan-4-yl)-3-[5-[4-(trifluoromethoxy)phenyl]-1H-imidazol-2-yl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | FC(F)(F)Oc1ccc(-c2cnc([C@H]3Cc4c([nH]c5ccccc45)[C@@H](C4CCOCC4)N3)[nH]2)cc1 |
| InChI | InChI=1S/C26H25F3N4O2/c27-26(28,29)35-17-7-5-15(6-8-17)22-14-30-25(33-22)21-13-19-18-3-1-2-4-20(18)31-24(19)23(32-21)16-9-11-34-12-10-16/h1-8,14,16,21,23,31-32H,9-13H2,(H,30,33)/t21-,23-/m1/s1 |
| InChIKey | SNSIAHRYDCJHNH-FYYLOGMGSA-N |
| XLogP | 5.81 |
| TPSA | 74.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|