C24H22F3N3O4S2 — CID 127030665
(4R)-4-[2-(1,2,3,6-tetrahydropyridin-4-yl)-4-(trifluoromethyl)phenoxy]-N-(1,3-thiazol-2-yl)-3,4-dihydro-2H-chromene-7-sulfonamide (PubChem CID 127030665) has the molecular formula C24H22F3N3O4S2 and a molecular weight of 537.59 g/mol. Its IUPAC name is (4R)-4-[2-(1,2,3,6-tetrahydropyridin-4-yl)-4-(trifluoromethyl)phenoxy]-N-(1,3-thiazol-2-yl)-3,4-dihydro-2H-chromene-7-sulfonamide.
| Compound Name | (4R)-4-[2-(1,2,3,6-tetrahydropyridin-4-yl)-4-(trifluoromethyl)phenoxy]-N-(1,3-thiazol-2-yl)-3,4-dihydro-2H-chromene-7-sulfonamide |
|---|---|
| PubChem CID | 127030665 |
| Molecular Formula | C24H22F3N3O4S2 |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.10 |
| IUPAC Name | (4R)-4-[2-(1,2,3,6-tetrahydropyridin-4-yl)-4-(trifluoromethyl)phenoxy]-N-(1,3-thiazol-2-yl)-3,4-dihydro-2H-chromene-7-sulfonamide |
| SMILES | O=S(=O)(Nc1nccs1)c1ccc2c(c1)OCC[C@H]2Oc1ccc(C(F)(F)F)cc1C1=CCNCC1 |
| InChI | InChI=1S/C24H22F3N3O4S2/c25-24(26,27)16-1-4-20(19(13-16)15-5-8-28-9-6-15)34-21-7-11-33-22-14-17(2-3-18(21)22)36(31,32)30-23-29-10-12-35-23/h1-5,10,12-14,21,28H,6-9,11H2,(H,29,30)/t21-/m1/s1 |
| InChIKey | KGEQIACBWYVPHG-OAQYLSRUSA-N |
| XLogP | 5.24 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |