C27H27NO6 — CID 127030752
(2S,3S)-2,3-bis(1,3-benzodioxol-5-ylmethyl)-N-benzyl-4-hydroxybutanamide (PubChem CID 127030752) has the molecular formula C27H27NO6 and a molecular weight of 461.51 g/mol. Its IUPAC name is (2S,3S)-2,3-bis(1,3-benzodioxol-5-ylmethyl)-N-benzyl-4-hydroxybutanamide.
| Compound Name | (2S,3S)-2,3-bis(1,3-benzodioxol-5-ylmethyl)-N-benzyl-4-hydroxybutanamide |
|---|---|
| PubChem CID | 127030752 |
| Molecular Formula | C27H27NO6 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | (2S,3S)-2,3-bis(1,3-benzodioxol-5-ylmethyl)-N-benzyl-4-hydroxybutanamide |
| SMILES | O=C(NCc1ccccc1)[C@@H](Cc1ccc2c(c1)OCO2)[C@@H](CO)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H27NO6/c29-15-21(10-19-6-8-23-25(12-19)33-16-31-23)22(27(30)28-14-18-4-2-1-3-5-18)11-20-7-9-24-26(13-20)34-17-32-24/h1-9,12-13,21-22,29H,10-11,14-17H2,(H,28,30)/t21-,22+/m1/s1 |
| InChIKey | KDDMXTUBEWQLCF-YADHBBJMSA-N |
| XLogP | 3.47 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |