About 8,9-bis[(3,5-dimethoxyphenyl)methoxy]-4-ethyl-5-methyl-6H-phenanthridine
8,9-bis[(3,5-dimethoxyphenyl)methoxy]-4-ethyl-5-methyl-6H-phenanthridine (PubChem CID 127030796) has the molecular formula C34H37NO6
and a molecular weight of 555.67 g/mol. Its IUPAC name is 8,9-bis[(3,5-dimethoxyphenyl)methoxy]-4-ethyl-5-methyl-6H-phenanthridine.
Molecular Properties
| Compound Name | 8,9-bis[(3,5-dimethoxyphenyl)methoxy]-4-ethyl-5-methyl-6H-phenanthridine |
| PubChem CID | 127030796 |
| Molecular Formula | C34H37NO6 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | 8,9-bis[(3,5-dimethoxyphenyl)methoxy]-4-ethyl-5-methyl-6H-phenanthridine |
| SMILES | CCc1cccc2c1N(C)Cc1cc(OCc3cc(OC)cc(OC)c3)c(OCc3cc(OC)cc(OC)c3)cc1-2 |
| InChI | InChI=1S/C34H37NO6/c1-7-24-9-8-10-30-31-18-33(41-21-23-13-28(38-5)17-29(14-23)39-6)32(15-25(31)19-35(2)34(24)30)40-20-22-11-26(36-3)16-27(12-22)37-4/h8-18H,7,19-21H2,1-6H3 |
| InChIKey | CZQLZOVXGDZPNA-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 8,9-bis[(3,5-dimethoxyphenyl)methoxy]-4-ethyl-5-methyl-6H-phenanthridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,9-bis[(3,5-dimethoxyphenyl)methoxy]-4-ethyl-5-methyl-6H-phenanthridine?
The IUPAC name of 8,9-bis[(3,5-dimethoxyphenyl)methoxy]-4-ethyl-5-methyl-6H-phenanthridine (CID 127030796) is 8,9-bis[(3,5-dimethoxyphenyl)methoxy]-4-ethyl-5-methyl-6H-phenanthridine.
What is the SMILES notation for 8,9-bis[(3,5-dimethoxyphenyl)methoxy]-4-ethyl-5-methyl-6H-phenanthridine?
The canonical SMILES for 8,9-bis[(3,5-dimethoxyphenyl)methoxy]-4-ethyl-5-methyl-6H-phenanthridine is CCc1cccc2c1N(C)Cc1cc(OCc3cc(OC)cc(OC)c3)c(OCc3cc(OC)cc(OC)c3)cc1-2.
What is the InChIKey of 8,9-bis[(3,5-dimethoxyphenyl)methoxy]-4-ethyl-5-methyl-6H-phenanthridine?
The InChIKey is CZQLZOVXGDZPNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H37NO6/c1-7-24-9-8-10-30-31-18-33(41-21-23-13-28(38-5)17-29(14-23)39-6)32(15-25(31)19-35(2)34(24)30)40-20-22-11-26(36-3)16-27(12-22)37-4/h8-18H,7,19-21H2,1-6H3.
What are the key properties of 8,9-bis[(3,5-dimethoxyphenyl)methoxy]-4-ethyl-5-methyl-6H-phenanthridine?
8,9-bis[(3,5-dimethoxyphenyl)methoxy]-4-ethyl-5-methyl-6H-phenanthridine has a molecular weight of 555.67 g/mol, XLogP of 7.06, 11 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-bis[(3,5-dimethoxyphenyl)methoxy]-4-ethyl-5-methyl-6H-phenanthridine is sourced from PubChem (CID 127030796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).