About 4-ethyl-5-methyl-8,9-bis[(5-pyrazol-1-yl-2-pyridinyl)methoxy]-6H-phenanthridine
4-ethyl-5-methyl-8,9-bis[(5-pyrazol-1-yl-2-pyridinyl)methoxy]-6H-phenanthridine (PubChem CID 127030802) has the molecular formula C34H31N7O2
and a molecular weight of 569.67 g/mol. Its IUPAC name is 4-ethyl-5-methyl-8,9-bis[(5-pyrazol-1-yl-2-pyridinyl)methoxy]-6H-phenanthridine.
Molecular Properties
| Compound Name | 4-ethyl-5-methyl-8,9-bis[(5-pyrazol-1-yl-2-pyridinyl)methoxy]-6H-phenanthridine |
| PubChem CID | 127030802 |
| Molecular Formula | C34H31N7O2 |
| Molecular Weight | 569.67 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | 4-ethyl-5-methyl-8,9-bis[(5-pyrazol-1-yl-2-pyridinyl)methoxy]-6H-phenanthridine |
| SMILES | CCc1cccc2c1N(C)Cc1cc(OCc3ccc(-n4cccn4)cn3)c(OCc3ccc(-n4cccn4)cn3)cc1-2 |
| InChI | InChI=1S/C34H31N7O2/c1-3-24-7-4-8-30-31-18-33(43-23-27-10-12-29(20-36-27)41-16-6-14-38-41)32(17-25(31)21-39(2)34(24)30)42-22-26-9-11-28(19-35-26)40-15-5-13-37-40/h4-20H,3,21-23H2,1-2H3 |
| InChIKey | KEMHMJZYJHAZHB-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 83.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 569.67 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 4-ethyl-5-methyl-8,9-bis[(5-pyrazol-1-yl-2-pyridinyl)methoxy]-6H-phenanthridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-5-methyl-8,9-bis[(5-pyrazol-1-yl-2-pyridinyl)methoxy]-6H-phenanthridine?
The IUPAC name of 4-ethyl-5-methyl-8,9-bis[(5-pyrazol-1-yl-2-pyridinyl)methoxy]-6H-phenanthridine (CID 127030802) is 4-ethyl-5-methyl-8,9-bis[(5-pyrazol-1-yl-2-pyridinyl)methoxy]-6H-phenanthridine.
What is the SMILES notation for 4-ethyl-5-methyl-8,9-bis[(5-pyrazol-1-yl-2-pyridinyl)methoxy]-6H-phenanthridine?
The canonical SMILES for 4-ethyl-5-methyl-8,9-bis[(5-pyrazol-1-yl-2-pyridinyl)methoxy]-6H-phenanthridine is CCc1cccc2c1N(C)Cc1cc(OCc3ccc(-n4cccn4)cn3)c(OCc3ccc(-n4cccn4)cn3)cc1-2.
What is the InChIKey of 4-ethyl-5-methyl-8,9-bis[(5-pyrazol-1-yl-2-pyridinyl)methoxy]-6H-phenanthridine?
The InChIKey is KEMHMJZYJHAZHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H31N7O2/c1-3-24-7-4-8-30-31-18-33(43-23-27-10-12-29(20-36-27)41-16-6-14-38-41)32(17-25(31)21-39(2)34(24)30)42-22-26-9-11-28(19-35-26)40-15-5-13-37-40/h4-20H,3,21-23H2,1-2H3.
What are the key properties of 4-ethyl-5-methyl-8,9-bis[(5-pyrazol-1-yl-2-pyridinyl)methoxy]-6H-phenanthridine?
4-ethyl-5-methyl-8,9-bis[(5-pyrazol-1-yl-2-pyridinyl)methoxy]-6H-phenanthridine has a molecular weight of 569.67 g/mol, XLogP of 6.19, 9 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-5-methyl-8,9-bis[(5-pyrazol-1-yl-2-pyridinyl)methoxy]-6H-phenanthridine is sourced from PubChem (CID 127030802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).