C10H10N4O2 — CID 127030808
3-(1H-pyrazol-5-ylmethylamino)pyridine-4-carboxylic acid (PubChem CID 127030808) has the molecular formula C10H10N4O2 and a molecular weight of 218.22 g/mol. Its IUPAC name is 3-(1H-pyrazol-5-ylmethylamino)pyridine-4-carboxylic acid.
| Compound Name | 3-(1H-pyrazol-5-ylmethylamino)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 127030808 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 3-(1H-pyrazol-5-ylmethylamino)pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccncc1NCc1ccn[nH]1 |
| InChI | InChI=1S/C10H10N4O2/c15-10(16)8-2-3-11-6-9(8)12-5-7-1-4-13-14-7/h1-4,6,12H,5H2,(H,13,14)(H,15,16) |
| InChIKey | JBRMNQGTCSOOQE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |