C13H11IO4 — CID 127030820
(5S,7S,8R,9R)-8-hydroxy-9-iodo-7-phenyl-1,6-dioxaspiro[4.4]non-3-en-2-one (PubChem CID 127030820) has the molecular formula C13H11IO4 and a molecular weight of 358.13 g/mol. Its IUPAC name is (5S,7S,8R,9R)-8-hydroxy-9-iodo-7-phenyl-1,6-dioxaspiro[4.4]non-3-en-2-one.
| Compound Name | (5S,7S,8R,9R)-8-hydroxy-9-iodo-7-phenyl-1,6-dioxaspiro[4.4]non-3-en-2-one |
|---|---|
| PubChem CID | 127030820 |
| Molecular Formula | C13H11IO4 |
| Molecular Weight | 358.13 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | (5S,7S,8R,9R)-8-hydroxy-9-iodo-7-phenyl-1,6-dioxaspiro[4.4]non-3-en-2-one |
| SMILES | O=C1C=C[C@@]2(O1)O[C@@H](c1ccccc1)[C@@H](O)[C@H]2I |
| InChI | InChI=1S/C13H11IO4/c14-12-10(16)11(8-4-2-1-3-5-8)18-13(12)7-6-9(15)17-13/h1-7,10-12,16H/t10-,11+,12-,13-/m1/s1 |
| InChIKey | DIVMRBFEKPKSDT-YVECIDJPSA-N |
| XLogP | 1.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.13 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|