C23H27NO2 — CID 127030821
(E)-3-[4-[(1R,3R)-3-methyl-2-(2-methylpropyl)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]prop-2-enoic acid (PubChem CID 127030821) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is (E)-3-[4-[(1R,3R)-3-methyl-2-(2-methylpropyl)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(1R,3R)-3-methyl-2-(2-methylpropyl)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 127030821 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | (E)-3-[4-[(1R,3R)-3-methyl-2-(2-methylpropyl)-3,4-dihydro-1H-isoquinolin-1-yl]phenyl]prop-2-enoic acid |
| SMILES | CC(C)CN1[C@H](c2ccc(/C=C/C(=O)O)cc2)c2ccccc2C[C@H]1C |
| InChI | InChI=1S/C23H27NO2/c1-16(2)15-24-17(3)14-20-6-4-5-7-21(20)23(24)19-11-8-18(9-12-19)10-13-22(25)26/h4-13,16-17,23H,14-15H2,1-3H3,(H,25,26)/b13-10+/t17-,23-/m1/s1 |
| InChIKey | MGDZEIOULYKLRY-BPOCNNFQSA-N |
| XLogP | 4.78 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|